For research use only. Not for therapeutic Use.
4-(Bromomethyl)benzaldehyde is an aromatic compound with a bromomethyl group and an aldehyde group attached to a benzene ring. This compound is a versatile intermediate in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and specialty chemicals. The bromomethyl group enables nucleophilic substitution reactions, while the aldehyde group offers functionality for further modifications, such as condensation reactions. Its dual reactivity makes it valuable for creating more complex molecules in research and industrial chemical processes.
CAS Number | 51359-78-5 |
Molecular Formula | C8H7BrO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-(bromomethyl)benzaldehyde |
InChI | InChI=1S/C8H7BrO/c9-5-7-1-3-8(6-10)4-2-7/h1-4,6H,5H2 |
InChIKey | XYPVBKDHERGKJG-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CBr)C=O |