For research use only. Not for therapeutic Use.
4-(bromomethyl)-N, N-diphenylamine(Cat No.:M126928) is a chemical compound used in organic synthesis as a precursor or intermediate for various applications. It contains a bromomethyl group attached to an aniline moiety with two phenyl groups. This compound is often used in the preparation of dyes, polymers, and pharmaceuticals due to its versatile reactivity. The bromomethyl group can undergo various substitution reactions, allowing for the introduction of other functional groups. Additionally, the diphenylamine scaffold provides structural stability and can participate in further chemical transformations, making this compound valuable in the synthesis of complex organic molecules.
CAS Number | 183994-94-7 |
Molecular Formula | C19H16BrN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-(bromomethyl)-N,N-diphenylaniline |
InChI | InChI=1S/C19H16BrN/c20-15-16-11-13-19(14-12-16)21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14H,15H2 |
InChIKey | FLQHEBWVRVQJIK-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |