For research use only. Not for therapeutic Use.
4-(Bromomethyl)phenylacetic acid (Cat.No:M062932) is a chemical compound with a bromine-substituted phenyl ring attached to an acetic acid moiety. It’s a versatile intermediate in organic synthesis, commonly used to create complex molecules for pharmaceuticals and other specialty chemicals. Its unique structure allows for diverse chemical transformations in research and industry.
CAS Number | 13737-36-5 |
Molecular Formula | C9H9BrO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-[4-(bromomethyl)phenyl]acetic acid |
InChI | InChI=1S/C9H9BrO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6H2,(H,11,12) |
InChIKey | WCOCCXZFEJGHTC-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CC(=O)O)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |