For research use only. Not for therapeutic Use.
4-(Bromomethyl)benzo[b]thiophene is an aromatic compound featuring a benzo[b]thiophene core with a bromomethyl substituent at the 4-position. This structure combines the properties of both thiophene and benzene, enhancing its electronic characteristics and reactivity. The presence of the bromomethyl group allows for various chemical transformations, making it useful in organic synthesis and materials science. This compound may serve as an intermediate for developing pharmaceuticals, agrochemicals, or novel materials, facilitating the exploration of structure-activity relationships in chemical research.
CAS Number | 10133-19-4 |
Molecular Formula | C9H7BrS |
Purity | ≥95% |
IUPAC Name | 4-(bromomethyl)-1-benzothiophene |
InChI | InChI=1S/C9H7BrS/c10-6-7-2-1-3-9-8(7)4-5-11-9/h1-5H,6H2 |
InChIKey | BWSYNCRSNIKJGK-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C=CSC2=C1)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |