For research use only. Not for therapeutic Use.
4-Bromophenylacetic Acid(Cat No.:R005874)is an organic compound characterized by a bromine atom attached to a phenyl ring, with an acetic acid functional group. This compound is often used in organic synthesis as an intermediate in the production of pharmaceuticals and agrochemicals. Its unique structure provides a framework for developing various derivatives with potential biological activities. Research has indicated that 4-Bromophenylacetic Acid may exhibit anti-inflammatory and analgesic properties, making it of interest in medicinal chemistry. Additionally, its role in studying reaction mechanisms and compound interactions enhances its significance in chemical research.
CAS Number | 1878-68-8 |
Synonyms | 4-Bromobenzeneacetic Acid; (p-Bromophenyl)acetic acid; 2-(4-Bromophenyl)acetic acid; NSC 14358; |
Molecular Formula | C8H7BrO2 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 2-(4-bromophenyl)acetic acid |
InChI | InChI=1S/C8H7BrO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
InChIKey | QOWSWEBLNVACCL-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CC(=O)O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |