For research use only. Not for therapeutic Use.
(4-Bromophenyl)diphenylphosphine(Cat No.:L006781), is an organophosphorus compound. It features a diphenylphosphine group (Ph2P) substituted with a 4-bromophenyl group. This compound is essential in organometallic chemistry and catalysis, acting as a ligand in transition metal complexes. Its versatile coordination properties make it valuable in various catalytic processes, including Suzuki-Miyaura cross-coupling reactions and Heck reactions. Researchers utilize it in the synthesis of complex molecules, contributing to advancements in pharmaceuticals and materials science.
CAS Number | 734-59-8 |
Molecular Formula | C18H14BrP |
Purity | ≥95% |
IUPAC Name | (4-bromophenyl)-diphenylphosphane |
InChI | InChI=1S/C18H14BrP/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H |
InChIKey | YNLBCLNFEOKEHA-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |