For research use only. Not for therapeutic Use.
4-Bromopicolinamide is an organic compound with the molecular formula C₆H₄BrN₃O. It features a picolinamide structure, with a bromine substituent at the 4-position. This compound typically appears as a solid and is of interest in medicinal chemistry due to its potential applications in drug discovery and development. The presence of the bromine atom may enhance its biological activity, making it a candidate for various therapeutic uses. Its unique structure also offers opportunities for synthesizing new bioactive molecules and studying their effects.
CAS Number | 62150-46-3 |
Molecular Formula | C6H5BrN2O |
Purity | ≥95% |
IUPAC Name | 4-bromopyridine-2-carboxamide |
InChI | InChI=1S/C6H5BrN2O/c7-4-1-2-9-5(3-4)6(8)10/h1-3H,(H2,8,10) |
InChIKey | HOKMIQUAXGAICH-UHFFFAOYSA-N |
SMILES | C1=CN=C(C=C1Br)C(=O)N |