For research use only. Not for therapeutic Use.
4-Bromothiophene-2-acetic acid is a halogenated thiophene derivative featuring a bromine atom at the 4th position and an acetic acid group at the 2nd position of the thiophene ring. This compound is valuable in organic synthesis, especially in the preparation of pharmaceuticals, agrochemicals, and functional materials. The bromine atom enhances its reactivity, enabling cross-coupling reactions, while the acetic acid group allows for further modifications. Researchers explore its potential in developing bioactive molecules and as a versatile intermediate in chemical synthesis.
CAS Number | 161942-89-8 |
Molecular Formula | C6H5BrO2S |
Purity | ≥95% |
Storage | 4°C |
IUPAC Name | 2-(4-bromothiophen-2-yl)acetic acid |
InChI | InChI=1S/C6H5BrO2S/c7-4-1-5(10-3-4)2-6(8)9/h1,3H,2H2,(H,8,9) |
InChIKey | RQLBAXZWESSFHI-UHFFFAOYSA-N |
SMILES | C1=C(SC=C1Br)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |