For research use only. Not for therapeutic Use.
4-Butylthiophenylboronic Acid(CAT: M135920) is a boronic acid derivative featuring a butyl-substituted phenyl ring, commonly employed in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions. This compound’s structure allows it to act as an effective building block for creating carbon-carbon bonds, making it valuable in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. The butyl chain imparts hydrophobic characteristics, which can influence the solubility and bioavailability of resulting compounds in medicinal chemistry applications. 4-Butylthiophenylboronic Acid is a versatile reagent, essential for designing complex molecular architectures in drug development and material science.
Catalog Number | M135920 |
CAS Number | 151588-38-4 |
Molecular Formula | C10H15BO2S |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | (4-butylsulfanylphenyl)boronic acid |
InChI | InChI=1S/C10H15BO2S/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h4-7,12-13H,2-3,8H2,1H3 |
InChIKey | BZLVENAORLQLEA-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)SCCCC)(O)O |