For research use only. Not for therapeutic Use.
4-Carbamimidoylbenzoic acid hydrochloride(CAT: L024432) is a benzoic acid derivative featuring a carbamimidoyl (guanidine) group at the 4-position, typically in the form of its hydrochloride salt. This compound is valuable in pharmaceutical and biochemical research, where it serves as an intermediate or building block in the synthesis of bioactive molecules, including enzyme inhibitors and receptor ligands. The presence of both the carboxylic acid and carbamimidoyl groups allows it to participate in hydrogen bonding, enhancing its interactions in biological systems. Researchers often utilize 4-Carbamimidoylbenzoic acid hydrochloride in studies related to metabolic pathways and drug development, as it offers structural versatility for modifications aimed at optimizing bioactivity and pharmacokinetic properties.
CAS Number | 42823-72-3 |
Molecular Formula | C8H9ClN2O2 |
Purity | ≥95% |
IUPAC Name | 4-carbamimidoylbenzoic acid;hydrochloride |
InChI | InChI=1S/C8H8N2O2.ClH/c9-7(10)5-1-3-6(4-2-5)8(11)12;/h1-4H,(H3,9,10)(H,11,12);1H |
InChIKey | LWZWTSNXTMLZNG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |