For research use only. Not for therapeutic Use.
4-Carbamoylphenylboronic acid(Cat No.:M016420)is an organic compound featuring a boronic acid group and a carbamoyl group attached to a phenyl ring. It is widely used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a versatile building block for creating complex molecules. This compound is significant in medicinal chemistry for the development of pharmaceuticals, as its structure allows for the formation of stable bonds with various functional groups. Additionally, its boronic acid moiety enables interactions with biomolecules, making it valuable in drug discovery and chemical biology.
CAS Number | 123088-59-5 |
Molecular Formula | C7H8BNO3 |
Purity | ≥95% |
IUPAC Name | (4-carbamoylphenyl)boronic acid |
InChI | InChI=1S/C7H8BNO3/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4,11-12H,(H2,9,10) |
InChIKey | GNRHNKBJNUVWFZ-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)C(=O)N)(O)O |