For research use only. Not for therapeutic Use.
4-Carbethoxyimidazole (Cat.No:R022680) is a chemical compound with potential applications in organic synthesis. It contains an imidazole ring substituted with a carbethoxy group. This compound serves as a versatile building block in the development of various pharmaceuticals and agrochemicals. Its unique structure enables the creation of diverse molecular structures for specific applications.
Catalog Number | R022680 |
CAS Number | 23785-21-9 |
Synonyms | 1H-Imidazole-5-carboxylic Acid Ethyl Ester; 4-(Ethoxycarbonyl)imidazole; C 751; C 751 (pharmaceutical); Ethyl 1H-Imidazole-4-carboxylate; Ethyl 4-imidazolecarboxylate; NSC 191283; |
Molecular Formula | C6H8N2O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | ethyl 1H-imidazole-5-carboxylate |
InChI | InChI=1S/C6H8N2O2/c1-2-10-6(9)5-3-7-4-8-5/h3-4H,2H2,1H3,(H,7,8) |
InChIKey | KLWYPRNPRNPORS-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CN=CN1 |