For research use only. Not for therapeutic Use.
4-Carboxy-3-(trifluoromethyl)phenylboronic acid pinacol ester (Cat.No:L003910) is a pivotal compound in organic synthesis. Its unique structure, combining a phenylboronic acid moiety with a trifluoromethyl group, imparts distinctive reactivity. This compound serves as a valuable reagent in the preparation of specialized molecules for applications in pharmaceutical and chemical research.
| Catalog Number | L003910 |
| CAS Number | 2121513-72-0 |
| Molecular Formula | C14H16BF3O4 |
| Purity | ≥95% |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoic acid |
| InChI | InChI=1S/C14H16BF3O4/c1-12(2)13(3,4)22-15(21-12)8-5-6-9(11(19)20)10(7-8)14(16,17)18/h5-7H,1-4H3,(H,19,20) |
| InChIKey | WGMLHOOENBAYCN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)O)C(F)(F)F |
