For research use only. Not for therapeutic Use.
4-Chloro-1H-pyrazolo[3,4-d]pyrimidine (Cat.No:R007973) is a heterocyclic compound used in pharmaceutical and agrochemical research. Its unique structure makes it a valuable building block in the synthesis of biologically active compounds. This pyrazolopyrimidine derivative has shown potential in various medicinal applications, warranting further investigation in drug discovery.
Catalog Number | R007973 |
CAS Number | 5399-92-8 |
Synonyms | 4-Chloropyrazolo[3,4-d]pyrimidine; NSC 4937; |
Molecular Formula | C5H3ClN4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 4-chloro-1H-pyrazolo[3,4-d]pyrimidine |
InChI | InChI=1S/C5H3ClN4/c6-4-3-1-9-10-5(3)8-2-7-4/h1-2H,(H,7,8,9,10) |
InChIKey | YMXQUFUYCADCFL-UHFFFAOYSA-N |
SMILES | C1=NNC2=C1C(=NC=N2)Cl |