For research use only. Not for therapeutic Use.
4-Chloro-2-[(ethylamino)methyl]phenol is an aromatic compound featuring a phenol ring with a chlorine substituent at the 4-position and an ethylamino group attached to a methylene bridge at the 2-position. This structure imparts interesting chemical properties, making it useful in organic synthesis and medicinal chemistry. The ethylamino group can enhance biological activity, potentially serving as a building block for developing pharmaceuticals. Its unique functional groups allow for various modifications, facilitating exploration of structure-activity relationships in chemical research and drug development.
CAS Number | 1016500-71-2 |
Molecular Formula | C9H12ClNO |
Purity | ≥95% |
IUPAC Name | 4-chloro-2-(ethylaminomethyl)phenol |
InChI | InChI=1S/C9H12ClNO/c1-2-11-6-7-5-8(10)3-4-9(7)12/h3-5,11-12H,2,6H2,1H3 |
InChIKey | IGZGODFWUJDHQK-UHFFFAOYSA-N |
SMILES | CCNCC1=C(C=CC(=C1)Cl)O |