For research use only. Not for therapeutic Use.
4-Chloro-2-(ethylthio)quinazoline(CAT: L000025) is a chemical compound primarily employed in the field of organic chemistry. It plays a crucial role as an intermediate in the synthesis of various organic compounds, contributing to the diversification of chemical synthesis. Its unique structure, with a chlorine and an ethylthio group, provides opportunities for creating specialized molecules with potential applications in various areas within the field of organic chemistry.
CAS Number | 58803-78-4 |
Molecular Formula | C10H9ClN2S |
Purity | ≥95% |
IUPAC Name | 4-chloro-2-ethylsulfanylquinazoline |
InChI | InChI=1S/C10H9ClN2S/c1-2-14-10-12-8-6-4-3-5-7(8)9(11)13-10/h3-6H,2H2,1H3 |
InChIKey | YXMGMRFURWMKDY-UHFFFAOYSA-N |