For research use only. Not for therapeutic Use.
4-Chloro-2-fluoro-6-methylbenzonitrile(CAT: L000345) is a compound of significance in the fields of organic chemistry and material science. This chemical, characterized by its combination of chlorine, fluorine, and a methyl group on a benzonitrile scaffold, serves as a valuable intermediate in organic synthesis. It is often used in organic chemistry for the creation of structurally diverse compounds and as a key building block for various chemical transformations.
CAS Number | 1805454-71-0 |
Molecular Formula | C8H5ClFN |
Purity | ≥95% |
IUPAC Name | 4-chloro-2-fluoro-6-methylbenzonitrile |
InChI | InChI=1S/C8H5ClFN/c1-5-2-6(9)3-8(10)7(5)4-11/h2-3H,1H3 |
InChIKey | DANFQUYARGFMOD-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |