For research use only. Not for therapeutic Use.
4-Chloro-2-iodobenzonitrile is an organic compound with the formula C₈H₄ClI₁N. It features a benzene ring substituted with a chlorine atom at the para position and an iodine atom at the meta position, along with a nitrile (–C≡N) group. This compound is significant in organic synthesis and medicinal chemistry, often used as an intermediate for developing pharmaceuticals and agrochemicals. Its unique halogenated structure enables va
| CAS Number | 61272-75-1 |
| Molecular Formula | C7H3ClIN |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-2-iodobenzonitrile |
| InChI | InChI=1S/C7H3ClIN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| InChIKey | YRQAIFRITOPIGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)I)C#N |
