For research use only. Not for therapeutic Use.
4-Chloro-2-(methoxycarbonyl)phenylboronic acid(Cat No.:L007258), is a chemical compound employed in organic synthesis and pharmaceutical research. this compound contains a boronic acid group and a chloro-substituted phenyl ring, offering unique reactivity for various chemical transformations. Researchers use it as a key building block in the development of biologically active molecules and pharmaceutical agents. Its incorporation enhances the stability and reactivity of the resulting compounds, making it valuable in the creation of diverse organic structures. This compound plays a significant role in the synthesis of novel compounds with potential therapeutic applications.
CAS Number | 1612256-37-7 |
Molecular Formula | C8H8BClO4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (4-chloro-2-methoxycarbonylphenyl)boronic acid |
InChI | InChI=1S/C8H8BClO4/c1-14-8(11)6-4-5(10)2-3-7(6)9(12)13/h2-4,12-13H,1H3 |
InChIKey | CVYLRXWWSGNWHX-UHFFFAOYSA-N |
SMILES | B(C1=C(C=C(C=C1)Cl)C(=O)OC)(O)O |