For research use only. Not for therapeutic Use.
4-Chloro-2-methoxyphenol(Cat No.:R033786) is a synthetic compound that belongs to the class of chlorophenols. Its mode of action involves being a chlorinated phenolic compound. Pharmacologically, 4-chloro-2-methoxyphenol is not used as a therapeutic drug on its own. However, it is used in various industrial and research applications. It can be used as an intermediate in the synthesis of other chemicals or as a building block in organic synthesis. Additionally, it may find applications in the production of various products, such as pharmaceuticals, agrochemicals, and dyes.
CAS Number | 16766-30-6 |
Synonyms | 2-Methoxy-4-chlorophenol; 4-Chloroguaiacol; p-Chloroguaiacol; |
Molecular Formula | C7H7ClO2 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 4-chloro-2-methoxyphenol |
InChI | InChI=1S/C7H7ClO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3 |
InChIKey | FVZQMMMRFNURSH-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)Cl)O |