For research use only. Not for therapeutic Use.
4-Chloro-2-methylbenzo[d]thiazol-5-amine(CAT: L000196) is a valuable compound with diverse applications in pharmaceutical and material chemistry. In pharmaceuticals, it serves as a key intermediate in the synthesis of medications targeting various biological pathways, making it essential for drug discovery and development. This compound’s unique structure and reactivity contribute to its importance in organic chemistry, facilitating the creation of complex molecules.
CAS Number | 686747-15-9 |
Molecular Formula | C8H7ClN2S |
Purity | ≥95% |
IUPAC Name | 4-chloro-2-methyl-1,3-benzothiazol-5-amine |
InChI | InChI=1S/C8H7ClN2S/c1-4-11-8-6(12-4)3-2-5(10)7(8)9/h2-3H,10H2,1H3 |
InChIKey | XEKLXLHCNBKGDJ-UHFFFAOYSA-N |