For research use only. Not for therapeutic Use.
4-Chloro-2-nitro-N-phenylaniline(Cat No.:M075269), It belongs to the class of nitroaniline derivatives and features both a chlorine atom and a nitro group (-NO2) attached to a phenyl ring, along with an aniline group (-NH2) at a different position on the ring. This compound’s structure makes it interesting for applications in organic synthesis and as an intermediate in the preparation of various chemicals. Its combination of functional groups could lead to diverse reactivity and potential utility in pharmaceutical and agrochemical synthesis.
CAS Number | 16611-15-7 |
Molecular Formula | C12H9ClN2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-chloro-2-nitro-N-phenylaniline |
InChI | InChI=1S/C12H9ClN2O2/c13-9-6-7-11(12(8-9)15(16)17)14-10-4-2-1-3-5-10/h1-8,14H |
InChIKey | GYOVQZDXSHTPBS-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NC2=C(C=C(C=C2)Cl)[N+](=O)[O-] |