For research use only. Not for therapeutic Use.
4-Chloro-2-phenylphenol is a bioactive chemical.
| Catalog Number | I020921 |
| CAS Number | 607-12-5 |
| Synonyms | 4-Chloro-2-phenylphenol |
| Molecular Formula | C12H9ClO |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4-Chloro-2-phenylphenol |
| InChI | InChI=1S/C12H9ClO/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h1-8,14H |
| InChIKey | DSQWWSVOIGUHAE-UHFFFAOYSA-N |
| SMILES | OC1=CC=C(Cl)C=C1C2=CC=CC=C2 |
