For research use only. Not for therapeutic Use.
4-Chloro-2-(trifluoromethoxy)benzaldehyde(Cat No.:L027210)is a halogenated aromatic aldehyde that combines a chloro group and a trifluoromethoxy group attached to a benzene ring. This structure is instrumental in chemical synthesis, especially in the pharmaceutical and agrochemical industries. The trifluoromethoxy group increases the electron-withdrawing capacity, enhancing the reactivity of the aldehyde group for nucleophilic addition reactions. Meanwhile, the chloro substituent allows for further functionalization through electrophilic substitution. This compound is frequently used as a building block for synthesizing advanced materials and active pharmaceutical ingredients with improved stability and activity.
CAS Number | 1261442-48-1 |
Molecular Formula | C8H4ClF3O2 |
Purity | ≥95% |
IUPAC Name | 4-chloro-2-(trifluoromethoxy)benzaldehyde |
InChI | InChI=1S/C8H4ClF3O2/c9-6-2-1-5(4-13)7(3-6)14-8(10,11)12/h1-4H |
InChIKey | SONFEJGLHKNKEF-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)OC(F)(F)F)C=O |