For research use only. Not for therapeutic Use.
4-Chloro-2,5-difluorobenzoic acid(Cat No.:M114382), is characterized by a benzoic acid structure with chlorine and two fluorine atoms attached to the aromatic ring. This compound’s unique halogen substitution pattern can make it valuable in organic synthesis, especially in the preparation of specialty chemicals and pharmaceutical intermediates. The specific arrangement of halogen atoms on the benzene ring contributes to its reactivity and potential for use as a building block in diverse chemical transformations, enabling the creation of compounds with tailored properties.
CAS Number | 132794-07-1 |
Molecular Formula | C7H3ClF2O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-chloro-2,5-difluorobenzoic acid |
InChI | InChI=1S/C7H3ClF2O2/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H,(H,11,12) |
InChIKey | PEPCYJSDHYMIFN-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1F)Cl)F)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |