For research use only. Not for therapeutic Use.
3-(4-Iodophenyl)-6-methyl-1,2,4,5-tetrazine（Cat No.:L007824）, is a chemical compound with diverse applications in research and industry. Its molecular structure consists of a tetrazine ring substituted with an iodophenyl and a methyl group. This compound is widely used in organic synthesis, medicinal chemistry, and materials science. Researchers leverage its unique reactivity, such as its participation in bioorthogonal reactions, making it valuable in the development of targeted drug delivery systems and diagnostic tools. Additionally, it finds applications in the field of materials chemistry, contributing to the creation of advanced materials and polymers.
| Catalog Number | L007825 |
| CAS Number | 62574-66-7 |
| Molecular Formula | C7H3Cl3O3S |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-3-chlorosulfonylbenzoyl chloride |
| InChI | InChI=1S/C7H3Cl3O3S/c8-5-2-1-4(7(9)11)3-6(5)14(10,12)13/h1-3H |
| InChIKey | PNXMCBFANZCXMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)S(=O)(=O)Cl)Cl |
