For research use only. Not for therapeutic Use.
4-Chloro-3-cyclopropylphenylboronic acid (CAt: L000162) is a crucial compound in the field of organic chemistry. It acts as a versatile building block for the synthesis of various pharmaceuticals and agrochemicals. Its unique cyclopropylphenylboronic acid structure makes it a valuable tool in medicinal chemistry, facilitating the development of potential drugs. This compound finds applications in pharmaceutical research, specifically in the design and synthesis of novel molecules with therapeutic properties.
CAS Number | 1548739-71-4 |
Molecular Formula | C9H10BClO2 |
Purity | ≥95% |
IUPAC Name | (4-chloro-3-cyclopropylphenyl)boronic acid |
InChI | InChI=1S/C9H10BClO2/c11-9-4-3-7(10(12)13)5-8(9)6-1-2-6/h3-6,12-13H,1-2H2 |
InChIKey | XTXQJDYURKNSTR-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |