For research use only. Not for therapeutic Use.
4-Chloro-3-formyl-benzenenitrile is an aromatic compound characterized by a benzene ring with a formyl group at the 3-position and a chloro substituent at the 4-position, along with a nitrile functional group. This unique combination of functionalities enhances its reactivity and versatility in organic synthesis. The formyl group allows for potential derivatization reactions, while the nitrile group can serve as a useful handle for further transformations. This compound may have applications in the development of pharmaceuticals and agrochemicals, making it valuable in chemical research.
CAS Number | 105191-41-1 |
Molecular Formula | C8H4ClNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-chloro-3-formylbenzonitrile |
InChI | InChI=1S/C8H4ClNO/c9-8-2-1-6(4-10)3-7(8)5-11/h1-3,5H |
InChIKey | JVRHVSUFKIQVFN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C#N)C=O)Cl |