For research use only. Not for therapeutic Use.
4-Chloro-3-methoxy-7-nitro-isocoumarin (CAT: L000163) is a significant chemical compound with diverse applications in various fields. In organic chemistry, this compound serves as a crucial intermediate in the synthesis of pharmaceuticals and agrochemicals. Its action mechanism involves participating in various chemical reactions, making it a versatile building block for the creation of complex molecules. In the pharmaceutical industry, it plays a role in drug discovery, where it’s used to design and synthesize potential medications.
CAS Number | 62252-25-9 |
Molecular Formula | C10H6ClNO5 |
Purity | ≥95% |
IUPAC Name | 4-chloro-3-methoxy-7-nitroisochromen-1-one |
InChI | InChI=1S/C10H6ClNO5/c1-16-10-8(11)6-3-2-5(12(14)15)4-7(6)9(13)17-10/h2-4H,1H3 |
InChIKey | XZLVSPYCCQKAAX-UHFFFAOYSA-N |