For research use only. Not for therapeutic Use.
4-Chloro-3-methoxyaniline (Cat.No:M059753) is a chemical compound used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its unique structure, featuring a chlorine and a methoxy group on an aniline ring, makes it valuable in the creation of diverse molecules for various applications.
CAS Number | 13726-14-2 |
Molecular Formula | C7H8ClNO |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 4-chloro-3-methoxyaniline |
InChI | InChI=1S/C7H8ClNO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,9H2,1H3 |
InChIKey | LNKBDFVSILQKSI-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |