Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
4-Chloro-3-morpholin-4-ylmethyl-phenylamine
For research use only, not for therapeutic use.
4-Chloro-3-morpholin-4-ylmethylphenylamine(Cat No.:L007792), is a chemical compound with the molecular formula C₉H₁₂ClN₂O. This compound features a chloro (Cl) substituent on the phenyl ring and a morpholin-4-ylmethyl moiety. The morpholine ring in its structure imparts unique properties, making it useful in medicinal chemistry and drug development. Compounds containing morpholine rings are often studied for their biological activities, especially in the context of pharmaceutical research. Researchers might investigate this compound’s potential in the development of novel drugs, considering its distinctive structural elements that could interact with biological targets, making it valuable in the exploration of new therapeutic agents.
Catalog Number | L007792 |
CAS Number | 769961-16-2 |
Molecular Formula | C11H15ClN2O |
Purity | ≥95% |
IUPAC Name | 4-chloro-3-(morpholin-4-ylmethyl)aniline |
InChI | InChI=1S/C11H15ClN2O/c12-11-2-1-10(13)7-9(11)8-14-3-5-15-6-4-14/h1-2,7H,3-6,8,13H2 |
InChIKey | KHBXNTAWKWNUIS-UHFFFAOYSA-N |
SMILES | C1COCCN1CC2=C(C=CC(=C2)N)Cl |