For research use only. Not for therapeutic Use.
4-Chloro-3-(trifluoromethoxy)benzaldehyde is an aromatic aldehyde with the formula C8H5ClF3O2. It consists of a benzene ring substituted with a chloro group (-Cl) at the 4-position and a trifluoromethoxy group (-O-CF3) at the 3-position, along with an aldehyde group (-CHO) at the 1-position. This compound is of interest in organic synthesis and medicinal chemistry due to the electron-withdrawing effects of the trifluoromethoxy group, which may influence its reactivity and biological activity in various applications.
| Catalog Number | L039958 |
| CAS Number | 886499-59-8 |
| Molecular Formula | C8H4ClF3O2 |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-3-(trifluoromethoxy)benzaldehyde |
| InChI | InChI=1S/C8H4ClF3O2/c9-6-2-1-5(4-13)3-7(6)14-8(10,11)12/h1-4H |
| InChIKey | XOHOCMBXDFQWDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)OC(F)(F)F)Cl |
