For research use only. Not for therapeutic Use.
4-Chloro-4′-methoxybiphenyl(Cat No.:L035518)is a biphenyl derivative where one phenyl ring carries a chlorine atom and the other a methoxy group, positioned para to each other. This structural configuration enhances its electronic properties and solubility, making it a valuable intermediate in organic synthesis, particularly in the production of liquid crystals, pharmaceuticals, and organic light-emitting diodes (OLEDs). The presence of chlorine and methoxy groups facilitates diverse chemical transformations, including Suzuki coupling, essential for constructing complex aromatic compounds. 4-Chloro-4′-methoxybiphenyl plays a crucial role in developing advanced materials and therapeutic agents.
CAS Number | 58970-19-7 |
Molecular Formula | C13H11ClO |
Purity | ≥95% |
IUPAC Name | 1-chloro-4-(4-methoxyphenyl)benzene |
InChI | InChI=1S/C13H11ClO/c1-15-13-8-4-11(5-9-13)10-2-6-12(14)7-3-10/h2-9H,1H3 |
InChIKey | PUVSUQVVUYQOBK-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |