For research use only. Not for therapeutic Use.
4-Chloro-4′-methoxybutyrophenone(Cat No.:L007027), is a chemical compound used primarily as an intermediate in pharmaceutical synthesis. It is a key building block in the preparation of certain medications and chemicals due to its unique structure, which incorporates a chloro-substituted benzophenone moiety with a methoxybutyrophenone side chain. This compound’s specialized structure and reactivity make it valuable in organic synthesis, enabling the creation of diverse molecules. Researchers use it in the development of pharmaceuticals, agrochemicals, and other biologically active compounds, contributing significantly to the advancement of medicinal chemistry, drug discovery, and related scientific fields.
CAS Number | 40877-19-8 |
Molecular Formula | C11H13ClO2 |
Purity | ≥95% |
IUPAC Name | 4-chloro-1-(4-methoxyphenyl)butan-1-one |
InChI | InChI=1S/C11H13ClO2/c1-14-10-6-4-9(5-7-10)11(13)3-2-8-12/h4-7H,2-3,8H2,1H3 |
InChIKey | NGBTWDPPZFGUAY-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C(=O)CCCCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |