For research use only. Not for therapeutic Use.
4-Chloro-5-fluoro-2-methylbenzoic acid(CAT: L000213) is a high-purity aromatic carboxylic acid with halogen and methyl substitutions, making it a versatile intermediate in pharmaceutical and chemical research. Its unique structure supports the synthesis of complex organic compounds, including bioactive molecules and advanced materials. This compound is particularly valuable in medicinal chemistry for developing novel therapeutic agents and as a building block in functional material design. With reliable quality and consistent performance, 4-Chloro-5-fluoro-2-methylbenzoic acid is an essential reagent for innovative research in drug discovery and organic synthesis.
CAS Number | 1427365-67-0 |
Molecular Formula | C8H6ClFO2 |
Purity | ≥95% |
IUPAC Name | 4-chloro-5-fluoro-2-methylbenzoic acid |
InChI | InChI=1S/C8H6ClFO2/c1-4-2-6(9)7(10)3-5(4)8(11)12/h2-3H,1H3,(H,11,12) |
InChIKey | DLZFKMYILRWTHU-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1C(=O)O)F)Cl |