For research use only. Not for therapeutic Use.
4-Chloro-5H-pyrimido[4,5-b][1,4]oxazin-6(7H)-one is a fused heterocyclic compound featuring a chloro-substituted pyrimidine ring and an oxazine moiety. This compound is of interest in medicinal chemistry due to its potential biological activities, including antitumor and antimicrobial properties. The presence of the chloro group enhances its reactivity, facilitating further chemical modifications. Its unique structure allows for the exploration of new therapeutic applications, making it valuable in the synthesis of novel bioactive compounds and in various chemical research endeavors.
Catalog Number | L020194 |
CAS Number | 1211524-67-2 |
Molecular Formula | C6H4ClN3O2 |
Purity | ≥95% |
IUPAC Name | 4-chloro-5H-pyrimido[4,5-b][1,4]oxazin-6-one |
InChI | InChI=1S/C6H4ClN3O2/c7-5-4-6(9-2-8-5)12-1-3(11)10-4/h2H,1H2,(H,10,11) |
InChIKey | RNPWYVDIKXJOJZ-UHFFFAOYSA-N |
SMILES | C1C(=O)NC2=C(O1)N=CN=C2Cl |