Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-Chloro-6-(4-chlorophenyl)-2-phenylpyrimidine
For research use only. Not for therapeutic Use.
4-Chloro-6-(4-chlorophenyl)-2-phenylpyrimidine (Cat.No:L004187) is a significant chemical compound with diverse applications. Its unique structure, incorporating chlorophenyl and phenylpyrimidine moieties, imparts distinctive reactivity. This compound finds utility as a key intermediate in the synthesis of specialized molecules with potential applications in pharmaceutical and agrochemical research.
CAS Number | 1354749-13-5 |
Molecular Formula | C16H10Cl2N2 |
Purity | ≥95% |
IUPAC Name | 4-chloro-6-(4-chlorophenyl)-2-phenylpyrimidine |
InChI | InChI=1S/C16H10Cl2N2/c17-13-8-6-11(7-9-13)14-10-15(18)20-16(19-14)12-4-2-1-3-5-12/h1-10H |
InChIKey | AMIWORWNWXAMJA-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC(=CC(=N2)Cl)C3=CC=C(C=C3)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |