Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-Chloro-6-fluoro-8-methylquinoline-3-carbonitrile
For research use only. Not for therapeutic Use.
4-Chloro-6-fluoro-8-methylquinoline-3-carbonitrile(Cat No.:L007218), is a chemical compound with the molecular formula C11H6ClFN2. It consists of a quinoline ring—a fused benzene and pyridine ring system—substituted with chloro, fluoro, methyl, and cyano groups at specific positions. This compound is significant in medicinal chemistry and drug discovery research. Its quinoline scaffold is often found in pharmaceuticals, making it valuable for the synthesis of novel bioactive molecules. Researchers use 4-Chloro-6-fluoro-8-methylquinoline-3-carbonitrile as a key intermediate, enabling the creation of diverse organic compounds, and contributing to advancements in drug discovery and medicinal chemistry efforts.
Catalog Number | L007218 |
CAS Number | 1016773-98-0 |
Molecular Formula | C11H6ClFN2 |
Purity | ≥95% |
IUPAC Name | 4-chloro-6-fluoro-8-methylquinoline-3-carbonitrile |
InChI | InChI=1S/C11H6ClFN2/c1-6-2-8(13)3-9-10(12)7(4-14)5-15-11(6)9/h2-3,5H,1H3 |
InChIKey | LXTFNZUCUGAACF-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC2=C(C(=CN=C12)C#N)Cl)F |