For research use only. Not for therapeutic Use.
4-Chloro-6-hydrazinyl-2-methylpyrimidine(Cat No.:L007370), is a chemical compound characterized by a pyrimidine ring with a chloro group at the 4th carbon, a hydrazinyl group (-NHNH2) at the 6th carbon, and a methyl group at the 2nd carbon position. This unique structure renders it valuable in the fields of organic synthesis, medicinal chemistry, and materials science. Researchers employ it as a building block in the design and creation of various organic compounds, exploring its potential applications in pharmaceuticals and related industries.
Catalog Number | L007370 |
CAS Number | 52476-88-7 |
Molecular Formula | C5H7ClN4 |
Purity | ≥95% |
IUPAC Name | (6-chloro-2-methylpyrimidin-4-yl)hydrazine |
InChI | InChI=1S/C5H7ClN4/c1-3-8-4(6)2-5(9-3)10-7/h2H,7H2,1H3,(H,8,9,10) |
InChIKey | FSVBHXYINVNNKS-UHFFFAOYSA-N |
SMILES | CC1=NC(=CC(=N1)Cl)NN |