For research use only. Not for therapeutic Use.
4-Chloro-6-methoxy-2-methylpyrimidin-5-amine(Cat No.:L014223)is a heterocyclic compound featuring chlorine, methoxy, and methyl substituents on a pyrimidine ring. This compound is valuable in pharmaceutical and agrochemical research as an intermediate for synthesizing bioactive molecules, including herbicides, fungicides, and potential drug candidates. Its structure allows for versatile chemical modifications, making it useful in creating compounds with specific biological activities. The presence of the amine group further enhances its reactivity, enabling the development of diverse chemical entities. High purity ensures reliable performance in advanced research and development applications.
CAS Number | 88474-31-1 |
Molecular Formula | C6H8ClN3O |
Purity | ≥95% |
IUPAC Name | 4-chloro-6-methoxy-2-methylpyrimidin-5-amine |
InChI | InChI=1S/C6H8ClN3O/c1-3-9-5(7)4(8)6(10-3)11-2/h8H2,1-2H3 |
InChIKey | XOPAFBPYRUSQNI-UHFFFAOYSA-N |
SMILES | CC1=NC(=C(C(=N1)Cl)N)OC |