For research use only. Not for therapeutic Use.
(4-Chloro-6-methoxypyridin-3-yl)methanol(CAT: L000215) is a significant compound in organic chemistry, particularly in the synthesis of pharmaceutical and organic molecules. This compound serves as a crucial intermediate for creating various organic compounds, including pharmaceutical agents. Its chemical structure, featuring a pyridine ring and chloro substitution, allows for specific structural modifications, making it an essential component in the development of complex molecules.
CAS Number | 1807234-96-3 |
Molecular Formula | C7H8ClNO2 |
Purity | ≥95% |
IUPAC Name | (4-chloro-6-methoxypyridin-3-yl)methanol |
InChI | InChI=1S/C7H8ClNO2/c1-11-7-2-6(8)5(4-10)3-9-7/h2-3,10H,4H2,1H3 |
InChIKey | WZGXYDQBXYGXJM-UHFFFAOYSA-N |