For research use only. Not for therapeutic Use.
4-Chloro-6,7-dimethoxy-2-methylquinoline(Cat No.:L016650)is an important compound in pharmaceutical research and organic synthesis. Featuring a quinoline core with chlorine, methoxy, and methyl substituents, this compound is essential for the development of various bioactive molecules, including potential therapeutic agents. Its structure allows for diverse chemical modifications, making it valuable in medicinal chemistry for the synthesis of complex heterocyclic compounds. With high purity and reliable performance, 4-Chloro-6,7-dimethoxy-2-methylquinoline supports advanced research in drug discovery and the development of innovative chemical entities.
CAS Number | 100122-02-9 |
Molecular Formula | C12H12ClNO2 |
Purity | ≥95% |
IUPAC Name | 4-chloro-6,7-dimethoxy-2-methylquinoline |
InChI | InChI=1S/C12H12ClNO2/c1-7-4-9(13)8-5-11(15-2)12(16-3)6-10(8)14-7/h4-6H,1-3H3 |
InChIKey | RBFMLSFDCICSHW-UHFFFAOYSA-N |
SMILES | CC1=CC(=C2C=C(C(=CC2=N1)OC)OC)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |