For research use only. Not for therapeutic Use.
4-Chloro-6,8-dimethylquinoline(Cat No.:M137178)is a chemically modified quinoline with chlorine and methyl groups enhancing its electronic and physical properties. This compound is extensively used in the synthesis of pharmaceuticals, particularly antimalarial and antibacterial agents. Its chlorine atom at the 4-position makes it a reactive site for further chemical transformations, such as Suzuki coupling, which are essential in complex organic syntheses. Additionally, its dual methyl substitutions contribute to increased lipophilicity, improving its potential for crossing cell membranes, thus making it a valuable intermediate in developing more effective medicinal compounds.
CAS Number | 196803-72-2 |
Molecular Formula | C11H10ClN |
Purity | ≥95% |
IUPAC Name | 4-chloro-6,8-dimethylquinoline |
InChI | InChI=1S/C11H10ClN/c1-7-5-8(2)11-9(6-7)10(12)3-4-13-11/h3-6H,1-2H3 |
InChIKey | OREYGYAAYFXMIZ-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=CN=C2C(=C1)C)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |