Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-chloro-7-methoxy-1H-pyrazolo[4,3-c]pyridine
For research use only. Not for therapeutic Use.
4-Chloro-7-methoxy-1H-pyrazolo[4,3-c]pyridine(CAT: L013193) is a heterocyclic compound with a fused pyrazolo-pyridine ring system. The chlorine atom at position 4 and the methoxy group at position 7 contribute to the molecule’s reactivity and electronic properties. This structural motif is often found in bioactive molecules and is of interest in medicinal chemistry for the development of pharmaceutical agents. The pyrazolo[4,3-c]pyridine core is known for its role in kinase inhibitors and other therapeutic compounds. 4-Chloro-7-methoxy-1H-pyrazolo[4,3-c]pyridine serves as a valuable building block in the synthesis of drugs and chemical intermediates targeting various biological pathways.
CAS Number | 1609259-31-5 |
Molecular Formula | C7H6ClN3O |
Purity | ≥95% |
IUPAC Name | 4-chloro-7-methoxy-1H-pyrazolo[4,3-c]pyridine |
InChI | InChI=1S/C7H6ClN3O/c1-12-5-3-9-7(8)4-2-10-11-6(4)5/h2-3H,1H3,(H,10,11) |
InChIKey | WRGFAMAOTQLQDL-UHFFFAOYSA-N |