For research use only. Not for therapeutic Use.
4-Chloro-8-methoxy-2-methyl-quinazoline is a heterocyclic compound widely used in pharmaceutical research and organic synthesis. Its quinazoline core, substituted with chloro, methoxy, and methyl groups, provides unique reactivity, making it a valuable intermediate in the development of bioactive molecules. This compound is often employed in the synthesis of kinase inhibitors, anticancer agents, and other therapeutic compounds. Its versatile structure allows for further chemical modifications, contributing to advancements in medicinal chemistry and drug discovery efforts targeting various biological pathways.
CAS Number | 154288-17-2 |
Synonyms | 4-CHLORO-8-METHOXY-2-METHYL-QUINAZOLINE |
Molecular Formula | C10H9ClN2O |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 4-chloro-8-methoxy-2-methylquinazoline |
InChI | InChI=1S/C10H9ClN2O/c1-6-12-9-7(10(11)13-6)4-3-5-8(9)14-2/h3-5H,1-2H3 |
InChIKey | NVOQXCVZNXOFMM-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=CC=C2OC)C(=N1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |