For research use only. Not for therapeutic Use.
4-chloro-N-(furan-2-ylmethyl)aniline(Cat No.:L007648), is a chemical compound featuring an aniline core substituted with a chloro group at the 4-position and a furan-2-ylmethyl group at the N-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a key intermediate in the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals.
CAS Number | 33829-87-7 |
Molecular Formula | C11H10ClNO |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4-chloro-N-(furan-2-ylmethyl)aniline |
InChI | InChI=1S/C11H10ClNO/c12-9-3-5-10(6-4-9)13-8-11-2-1-7-14-11/h1-7,13H,8H2 |
InChIKey | SORYCONFCUFJND-UHFFFAOYSA-N |
SMILES | C1=COC(=C1)CNC2=CC=C(C=C2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |