For research use only. Not for therapeutic Use.
4-Chloro-N-methylquinazolin-2-amine (CAT: L000304) plays a pivotal role in pharmaceutical and material chemistry. Its primary action involves serving as a crucial intermediate in the synthesis of pharmaceutical compounds. This compound is utilized to create diverse drug candidates, particularly those with anti-inflammatory and anti-cancer properties. Moreover, material chemistry, contributes to the development of innovative materials with applications in various industries.
Catalog Number | L000304 |
CAS Number | 2090582-08-2 |
Molecular Formula | C9H8ClN3 |
Purity | ≥95% |
IUPAC Name | 4-chloro-N-methylquinazolin-2-amine |
InChI | InChI=1S/C9H8ClN3/c1-11-9-12-7-5-3-2-4-6(7)8(10)13-9/h2-5H,1H3,(H,11,12,13) |
InChIKey | WPDFEKVRRCHOQE-UHFFFAOYSA-N |