For research use only. Not for therapeutic Use.
4-chloro-N-(pyridin-3-ylmethyl)aniline(Cat No.:L007706), is a chemical compound containing a chloro-substituted aniline core with a pyridin-3-ylmethyl group attached to the amino group. This specific structure is essential in medicinal chemistry and organic synthesis. Researchers use it as a versatile intermediate for the synthesis of diverse organic compounds, especially in the development of pharmaceuticals and agrochemicals. Its applications are vital in the creation of complex molecules, contributing significantly to drug discovery, research, and the development of specialized chemicals, thus advancing advancements in chemical research and related fields.
CAS Number | 29083-43-0 |
Molecular Formula | C12H11ClN2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 4-chloro-N-(pyridin-3-ylmethyl)aniline |
InChI | InChI=1S/C12H11ClN2/c13-11-3-5-12(6-4-11)15-9-10-2-1-7-14-8-10/h1-8,15H,9H2 |
InChIKey | MLOJAKGCMJIRQY-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)CNC2=CC=C(C=C2)Cl |