For research use only. Not for therapeutic Use.
4-Chloro-N1-methylbenzene-1,2-diamine(Cat No.:L032767)is a high-purity aromatic amine widely used in pharmaceutical research and chemical synthesis. Featuring a chlorine atom and a methyl group on a benzene ring with two adjacent amine groups, this compound serves as a versatile intermediate in the development of complex organic molecules, including potential drug candidates. It is particularly valuable in medicinal chemistry for the synthesis of bioactive compounds and pharmaceutical intermediates. Ideal for advanced research, this compound ensures precision and reliability in experimental outcomes, supporting innovative drug discovery efforts.
CAS Number | 59681-66-2 |
Molecular Formula | C7H9ClN2 |
Purity | ≥95% |
IUPAC Name | 4-chloro-1-N-methylbenzene-1,2-diamine |
InChI | InChI=1S/C7H9ClN2/c1-10-7-3-2-5(8)4-6(7)9/h2-4,10H,9H2,1H3 |
InChIKey | UVUAKQQNONYKJK-UHFFFAOYSA-N |
SMILES | CNC1=C(C=C(C=C1)Cl)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |