For research use only. Not for therapeutic Use.
4-Chloroanisole-d4 is a high-purity deuterated compound essential for advanced pharmaceutical and chemical research. This isotopically labeled version of 4-Chloroanisole, featuring four deuterium atoms, is crucial for studies involving organic synthesis, reaction mechanisms, and environmental monitoring. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. 4-Chloroanisole-d4 is particularly useful in the investigation of halogenated aromatic compounds and the development of new chemical entities. With improved stability and consistency, it integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 1219804-86-0 |
Synonyms | 4-Chloroanisole–d4 |
Molecular Formula | C7H3ClD4O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-chloro-4-methoxybenzene |
InChI | InChI=1S/C7H7ClO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
InChIKey | YRGAYAGBVIXNAQ-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |